103777-67-9 Usage
Main properties
1. Composition: 2-Propenoic acid, 2-(dimethylamino)ethyl ester, polymer with 2-propenamide, sulfate.
2. Polymerization: Formed by the polymerization of the chemical components.
3. Copolymer: A type of polymer consisting of a combination of 2-Propenoic acid, 2-(dimethylamino)ethyl ester, and 2-propenamide, sulfate.
4. Versatile applications: Can be used in various industries such as manufacturing, pharmaceuticals, and research.
5. Unique characteristics: The specific chemical composition provides unique properties useful for specific purposes.
6. Presence of sulfate: Suggests potential applications in industries such as personal care, cosmetics, and adhesives.
2-Propenoic acid, 2-(dimethylamino)ethyl ester
One of the chemical components of the copolymer.
Polymer with 2-propenamide
Another chemical component of the copolymer.
Sulfate
Present in the chemical composition, indicating potential applications in personal care, cosmetics, and adhesives industries.
Various applications
Due to its unique properties, the polymer can be utilized in manufacturing, pharmaceuticals, and research industries, among others.
Check Digit Verification of cas no
The CAS Registry Mumber 103777-67-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,7,7 and 7 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 103777-67:
(8*1)+(7*0)+(6*3)+(5*7)+(4*7)+(3*7)+(2*6)+(1*7)=129
129 % 10 = 9
So 103777-67-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H13NO2.C3H5NO.H2O4S/c1-4-7(9)10-6-5-8(2)3;1-2-3(4)5;1-5(2,3)4/h4H,1,5-6H2,2-3H3;2H,1H2,(H2,4,5);(H2,1,2,3,4)
