10395-51-4 Usage
General Description
2,2-dimethoxynorbornane is a chemical compound with the molecular formula C9H16O2. It is a norbornane derivative with two methoxy groups attached to the carbon atoms at the 2 position. 2,2-dimethoxynorbornane is commonly used as a reagent in organic synthesis, particularly in the formation of various organic molecules. It is known for its stability and inertness, making it useful in a wide range of chemical reactions. 2,2-dimethoxynorbornane has also been studied for its potential applications in pharmaceuticals and materials science due to its unique structure and properties. Overall, this compound plays a critical role in the field of organic chemistry and has various potential applications in industry and research.
Check Digit Verification of cas no
The CAS Registry Mumber 10395-51-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,9 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10395-51:
(7*1)+(6*0)+(5*3)+(4*9)+(3*5)+(2*5)+(1*1)=84
84 % 10 = 4
So 10395-51-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H16O2/c1-10-9(11-2)6-7-3-4-8(9)5-7/h7-8H,3-6H2,1-2H3
