104575-40-8 Usage
General Description
2-(4-fluoro-phenyl)-4-methyl-1H-imidazole is a chemical compound with the molecular formula C9H8FN3. It is a derivative of imidazole, a five-membered heterocyclic ring containing two nitrogen atoms. 2-(4-FLUORO-PHENYL)-4-METHYL-1H-IMIDAZOLE is a potential pharmaceutical intermediate, with research indicating potential applications in the development of antifungal, antimicrobial, and anticancer drugs. The 4-methyl-1H-imidazole group in the compound provides a flexible backbone for the attachment of other functional groups, allowing for further modification and optimization of its biological activity. Additionally, the presence of the fluorine and phenyl groups may also play a significant role in the compound's pharmacological properties. Overall, 2-(4-fluoro-phenyl)-4-methyl-1H-imidazole holds potential for various pharmaceutical applications and further study.
Check Digit Verification of cas no
The CAS Registry Mumber 104575-40-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,5,7 and 5 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 104575-40:
(8*1)+(7*0)+(6*4)+(5*5)+(4*7)+(3*5)+(2*4)+(1*0)=108
108 % 10 = 8
So 104575-40-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H9FN2/c1-7-6-12-10(13-7)8-2-4-9(11)5-3-8/h2-6H,1H3,(H,12,13)