107779-32-8 Usage
Properties
1. Molecular formula: C19H23NO3
2. Chemical compound with a methoxy group and a phenoxypentoxy group attached to an aniline molecule
3. Used in organic synthesis and pharmaceutical research
4. White to off-white solid at room temperature
5. Soluble in organic solvents such as ethanol and methanol
6. Requires caution and proper safety protocols for handling
Specific content
1. Methoxy group
2. Phenoxypentoxy group
3. Potential biological properties
4. Used as a precursor in the synthesis of organic compounds
5. Health and environmental risks if mishandled
Check Digit Verification of cas no
The CAS Registry Mumber 107779-32-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,7,7 and 9 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 107779-32:
(8*1)+(7*0)+(6*7)+(5*7)+(4*7)+(3*9)+(2*3)+(1*2)=148
148 % 10 = 8
So 107779-32-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H23NO3/c1-20-18-14-15(19)10-11-17(18)22-13-7-3-6-12-21-16-8-4-2-5-9-16/h2,4-5,8-11,14H,3,6-7,12-13,19H2,1H3