112529-18-7 Usage
General Description
1,O(6)-ethanoguanosine is a chemical compound that is formed when the DNA base guanosine undergoes a modification at its O(6) position, resulting in the addition of an ethano group. This modification can occur as a result of exposure to various chemical agents or environmental carcinogens, leading to DNA damage. 1,O(6)-ethanoguanosine has been identified as a potential biomarker for exposure to these harmful agents and is being studied as a marker for assessing DNA damage in cells. Additionally, this modified nucleoside has been found to play a role in the formation of DNA adducts, which can contribute to mutagenesis and carcinogenesis. Research on 1,O(6)-ethanoguanosine is ongoing to further understand its potential impact on human health and its implications for the development of novel biomarkers and therapeutic interventions.
Check Digit Verification of cas no
The CAS Registry Mumber 112529-18-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,5,2 and 9 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 112529-18:
(8*1)+(7*1)+(6*2)+(5*5)+(4*2)+(3*9)+(2*1)+(1*8)=97
97 % 10 = 7
So 112529-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N5O5/c13-12-15-9-6(10-16(12)1-2-21-10)14-4-17(9)11-8(20)7(19)5(3-18)22-11/h4-5,7-8,11,13,18-20H,1-3H2/p+1/b13-12-/t5-,7-,8-,11?/m1/s1