114560-27-9 Usage
General Description
The chemical [(E)-3-[5-methoxy-3-(methoxycarbonyloxymethyl)-1-methyl-4,7-dioxo-indol-2-yl]prop-2-enyl] methyl carbonate is a complex molecule that contains four main functional groups: methoxy, carbonyl, propenyl, and carbonate. It is a derivative of the natural compound indole, with additional groups attached to its structure. The compound is characterized by its double bond and its methoxycarbonyloxymethyl side chain, which adds complexity to its structure. This chemical may have potential applications in organic synthesis, medicinal chemistry, or materials science due to its unique structure and functional groups. Further research and analysis are needed to elucidate its specific properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 114560-27-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,4,5,6 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 114560-27:
(8*1)+(7*1)+(6*4)+(5*5)+(4*6)+(3*0)+(2*2)+(1*7)=99
99 % 10 = 9
So 114560-27-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H19NO9/c1-19-11(6-5-7-27-17(22)25-3)10(9-28-18(23)26-4)14-15(19)12(20)8-13(24-2)16(14)21/h5-6,8H,7,9H2,1-4H3/b6-5+