114788-05-5 Usage
Description
(S)-4,5,6,7-Tetrahydro-3-phenylmethyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid dihydrochloride is a complex chemical compound characterized by the fusion of an imidazole ring with a pyridine ring, which may confer basicity and the ability to engage in hydrogen bonding. The presence of a phenylmethyl group introduces aromaticity, allowing for π-π interactions, while the carboxylic acid group indicates the compound's capability to form salts, as shown by its current dihydrochloride form with two chloride ions. These structural features suggest a variety of potential interactions and reactivity in biological and chemical contexts, promising diverse roles in chemical and pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
(S)-4,5,6,7-Tetrahydro-3-phenylmethyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid dihydrochloride is used as a pharmaceutical candidate for its potential interactions and reactivity due to its complex structure, including basicity, hydrogen bonding, aromaticity, and the ability to form salts. Its diverse properties make it a promising compound for the development of new drugs and therapeutic agents.
Used in Chemical Research:
In the field of chemical research, (S)-4,5,6,7-Tetrahydro-3-phenylmethyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid dihydrochloride serves as a subject of study for understanding its reactivity and potential applications in various chemical processes. Its unique structural features, such as the fused imidazole and pyridine rings, the phenylmethyl group, and the carboxylic acid group, provide opportunities for exploring novel chemical reactions and mechanisms.
Used in Drug Delivery Systems:
(S)-4,5,6,7-Tetrahydro-3-phenylmethyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid dihydrochloride can be employed in drug delivery systems to improve the bioavailability and therapeutic outcomes of pharmaceutical agents. Its ability to form salts and engage in various interactions may allow for the development of innovative drug delivery platforms, enhancing the efficacy and targeting of medications.
Check Digit Verification of cas no
The CAS Registry Mumber 114788-05-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,4,7,8 and 8 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 114788-05:
(8*1)+(7*1)+(6*4)+(5*7)+(4*8)+(3*8)+(2*0)+(1*5)=135
135 % 10 = 5
So 114788-05-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H15N3O2.2ClH/c18-14(19)12-6-11-13(7-15-12)17(9-16-11)8-10-4-2-1-3-5-10;;/h1-5,9,12,15H,6-8H2,(H,18,19);2*1H/t12-;;/m0../s1
