116530-55-3 Usage
General Description
3-(3-Amino-4-bromophenyl)propanoic acid is a chemical compound with the molecular formula C9H10BrNO2. As indicated by the name, it has an amino group (NH2) and a bromine atom attached to its phenyl ring, along with a propanoic acid group. The presence of these functional groups suggests that it may possess properties such as acidity and reactivity towards bases, nucleophiles, and electrophiles. This chemical could potentially be used in a variety of chemical reactions, and in the synthesis of various organic compounds. The exact properties and uses would depend on the specific chemical context and the other reactants involved. The compound might also be of potential interest in the development of pharmaceuticals, due to the ability of phenylpropanoic acids to act as bioisosteres for certain amino acids.
Check Digit Verification of cas no
The CAS Registry Mumber 116530-55-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,5,3 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 116530-55:
(8*1)+(7*1)+(6*6)+(5*5)+(4*3)+(3*0)+(2*5)+(1*5)=103
103 % 10 = 3
So 116530-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BrNO2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5H,2,4,11H2,(H,12,13)
