116734-15-7 Usage
Description
2-(4-Hydroxy-phenyl)-6-methyl-quinoline-4-carboxylic acid is a chemical compound with the molecular formula C17H13NO3. It is a member of the quinoline carboxylic acid family and a derivative of quinoline. 2-(4-HYDROXY-PHENYL)-6-METHYL-QUINOLINE-4-CARBOXYLIC ACID features a hydroxyphenyl group, a methyl group, and a carboxylic acid functional group. Its unique chemical structure and properties make it a valuable intermediate in the pharmaceutical industry for the synthesis of various drugs and organic compounds. Additionally, it holds potential in the fields of organic chemistry and material science due to its distinctive reactivity and structure.
Uses
Used in Pharmaceutical Industry:
2-(4-Hydroxy-phenyl)-6-methyl-quinoline-4-carboxylic acid is used as a chemical intermediate for the synthesis of various drugs and organic compounds. Its presence of a hydroxyphenyl and methyl group, along with the carboxylic acid functionality, contributes to its versatility in the development of new medications and chemical processes.
Used in Organic Chemistry:
In the field of organic chemistry, 2-(4-Hydroxy-phenyl)-6-methyl-quinoline-4-carboxylic acid is utilized for its unique structure and reactivity, enabling the creation of novel chemical entities and facilitating advanced chemical reactions.
Used in Material Science:
2-(4-Hydroxy-phenyl)-6-methyl-quinoline-4-carboxylic acid also finds potential applications in material science, where its distinct chemical properties can be leveraged to develop new materials with specific characteristics and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 116734-15-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,7,3 and 4 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 116734-15:
(8*1)+(7*1)+(6*6)+(5*7)+(4*3)+(3*4)+(2*1)+(1*5)=117
117 % 10 = 7
So 116734-15-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H13NO3/c1-10-2-7-15-13(8-10)14(17(20)21)9-16(18-15)11-3-5-12(19)6-4-11/h2-9,19H,1H3,(H,20,21)
