118584-57-9 Usage
General Description
"(2R,3R)-2-(4-nitrophenyl)-3-propyl-oxirane" is a chemical compound with a nitrophenyl group and an oxirane ring. The molecular formula of the compound is C9H11NO3, and it has a molecular weight of 181.19 g/mol. It is a chiral molecule with a specific spatial arrangement of its atoms, and its IUPAC name is (2R,3R)-2-(4-nitrophenyl)-3-propyl-oxirane. (2R,3R)-2-(4-nitrophenyl)-3-propyl-oxirane is commonly used in organic synthesis and chemical research, and it has potential applications in pharmaceuticals, agrochemicals, and materials science. The nitrophenyl group contributes to the compound's reactivity and can participate in various chemical reactions, making it a versatile building block for the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 118584-57-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,5,8 and 4 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 118584-57:
(8*1)+(7*1)+(6*8)+(5*5)+(4*8)+(3*4)+(2*5)+(1*7)=149
149 % 10 = 9
So 118584-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO3/c1-2-3-10-11(15-10)8-4-6-9(7-5-8)12(13)14/h4-7,10-11H,2-3H2,1H3/t10-,11-/m1/s1