12153-28-5 Usage
Description
(Hydrazinocarbonyl)ferrocene is a complex organic chemical compound that features a ferrocene core and a hydrazine carbonyl functional group. This unique chemical structure endows it with distinct chemical properties and reactivity. Although its direct applications have not been extensively documented in scientific literature, it is anticipated to function as a reactant in chemical reactions or as a precursor for the synthesis of more complex molecules.
Uses
Used in Chemical Synthesis:
(Hydrazinocarbonyl)ferrocene is used as a reactant in chemical reactions for its distinctive chemical properties and reactivity. It may be employed in the synthesis of more complex molecules, contributing to the development of novel compounds with potential applications in various fields.
Used in Research and Development:
In the context of research and development, (hydrazinocarbonyl)ferrocene is used as a precursor for the exploration of new chemical pathways and the creation of innovative molecules. Its unique structure provides a platform for scientists to investigate its potential in various chemical processes and applications.
Note: Since the toxicity and safety aspects of (hydrazinocarbonyl)ferrocene have not been widely documented, it is essential to exercise caution when handling this compound, especially in laboratory settings or industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 12153-28-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,1,5 and 3 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 12153-28:
(7*1)+(6*2)+(5*1)+(4*5)+(3*3)+(2*2)+(1*8)=65
65 % 10 = 5
So 12153-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N2O.C5H5.Fe/c7-8-6(9)5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H,7H2,(H,8,9);1-5H;/rC11H12FeN2O/c13-14-11(15)9-6-3-7-10(9)12-8-4-1-2-5-8/h1-8,10H,13H2,(H,14,15)
