126533-97-9 Usage
General Description
2-Morpholin-4-yl-1,3-thiazole-4-carboxaldehyde is a chemical compound that belongs to the class of thiazole derivatives. It is a heterocyclic compound that contains a thiazole ring with a morpholine and aldehyde functional group. 2-Morpholin-4-yl-1,3-thiazole-4-carboxaldehyde has shown potential pharmacological activities, including antimicrobial, antifungal, and antitumor properties. It has been studied for its biological activities and potential use as a drug candidate. Additionally, it has been used as a reagent in organic synthesis, particularly in the preparation of various heterocyclic compounds. Its unique structure and potential biological activities make it a valuable compound in medicinal and organic chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 126533-97-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,5,3 and 3 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 126533-97:
(8*1)+(7*2)+(6*6)+(5*5)+(4*3)+(3*3)+(2*9)+(1*7)=129
129 % 10 = 9
So 126533-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2S/c11-5-7-6-13-8(9-7)10-1-3-12-4-2-10/h5-6H,1-4H2
Harmful:;
