128574-89-0 Usage
Description
N-Acetyl-D-aspartic acid (NADAA) is a naturally occurring derivative of the neurotransmitter aspartate that is found in high levels in the pineal gland and testes of mammals. It plays a crucial role in the development and function of the nervous system, regulation of hormone production, and sexual behavior. NADAA has been proposed to have potential therapeutic applications in treating neurodegenerative diseases and reproductive disorders. Furthermore, it has been studied for its potential role in regulating the release of gonadotropin-releasing hormone and modulating the activity of NMDA receptors in the brain. Overall, NADAA represents an intriguing compound with diverse physiological functions and potential therapeutic implications.
Uses
Used in Pharmaceutical Industry:
N-ACETYL-D-ASPARTIC ACID is used as a therapeutic agent for treating neurodegenerative diseases and reproductive disorders due to its potential role in the development and function of the nervous system, regulation of hormone production, and sexual behavior.
Used in Neurological Research:
N-ACETYL-D-ASPARTIC ACID is used as a research compound for studying its potential role in regulating the release of gonadotropin-releasing hormone and modulating the activity of NMDA receptors in the brain, which could provide insights into the development of new treatments for neurological disorders.
Used in Hormone Regulation:
N-ACETYL-D-ASPARTIC ACID is used as a hormone regulator for its role in the regulation of hormone production, which may have implications in the treatment of hormonal imbalances and related conditions.
Used in Sexual Behavior Regulation:
N-ACETYL-D-ASPARTIC ACID is used as a modulator of sexual behavior due to its involvement in the regulation of sexual behavior, which could potentially be applied in the development of treatments for sexual dysfunction or related disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 128574-89-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,5,7 and 4 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 128574-89:
(8*1)+(7*2)+(6*8)+(5*5)+(4*7)+(3*4)+(2*8)+(1*9)=160
160 % 10 = 0
So 128574-89-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/t4-/m1/s1
