129744-24-7 Usage
General Description
Stellettamide A trifluoroacetate is a synthetic compound derived from the marine natural product stellettamide A, with potential anti-inflammatory and neuroprotective activities. It functions by inhibiting the production of pro-inflammatory cytokines, such as tumor necrosis factor alpha (TNF-alpha), interleukin-1 beta (IL-1beta), and interleukin-6 (IL-6). This inhibition may help reduce inflammation in various diseases and conditions. Additionally, stellettamide A trifluoroacetate has shown potential in protecting nerve cells from damage, suggesting a potential role in neuroprotection. STELLETTAMIDE A TRIFLUOROACETATE's unique properties make it a promising candidate for further research and potential therapeutic applications in the treatment of inflammatory and neurodegenerative diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 129744-24-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,7,4 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 129744-24:
(8*1)+(7*2)+(6*9)+(5*7)+(4*4)+(3*4)+(2*2)+(1*4)=147
147 % 10 = 7
So 129744-24-7 is a valid CAS Registry Number.
InChI:InChI=1/C26H44N2O/c1-21(2)10-8-11-22(3)12-9-13-23(4)15-16-26(29)27-20-24-17-19-28(5)18-7-6-14-25(24)28/h10,12,15-16,23-25H,6-9,11,13-14,17-20H2,1-5H3/p+1/b16-15+,22-12+/t23-,24-,25+,28-/m0/s1