13075-38-2 Usage
General Description
The chemical "Z-GLY-PRO-GLY-GLY-PRO-ALA-OH" is a synthetic peptide molecule consisting of the amino acids glycine (Gly), proline (Pro), and alanine (Ala) linked together in a specific sequence. The "Z" in the chemical name indicates that the molecule has a protective group attached to the amino group of the first glycine residue. Peptide molecules like "Z-GLY-PRO-GLY-GLY-PRO-ALA-OH" have various potential applications in biochemistry, medicine, and biotechnology, including as building blocks for the synthesis of larger proteins, as research tools for studying protein structure and function, and as potential therapeutic agents for treating various diseases. Further research and experimentation may be needed to fully understand the potential uses and effects of this specific peptide molecule.
Check Digit Verification of cas no
The CAS Registry Mumber 13075-38-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,0,7 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 13075-38:
(7*1)+(6*3)+(5*0)+(4*7)+(3*5)+(2*3)+(1*8)=82
82 % 10 = 2
So 13075-38-2 is a valid CAS Registry Number.
InChI:InChI=1/C27H36N6O9/c1-17(26(39)40)31-25(38)20-10-6-12-33(20)22(35)14-28-21(34)13-29-24(37)19-9-5-11-32(19)23(36)15-30-27(41)42-16-18-7-3-2-4-8-18/h2-4,7-8,17,19-20H,5-6,9-16H2,1H3,(H,28,34)(H,29,37)(H,30,41)(H,31,38)(H,39,40)/t17-,19-,20-/m0/s1