130755-08-7 Usage
General Description
((2-azido-4-benzyl)phenoxy)-N-ethylmorpholine is a chemical compound with a complex structure including an azide group, benzyl group, phenoxy group, and N-ethylmorpholine group. It is used as a building block for the synthesis of various organic compounds and pharmaceuticals. The azide group provides the compound with the potential to undergo click chemistry reactions, which are widely used in organic synthesis. The benzyl and phenoxy groups contribute to the compound’s structural and chemical properties, while the N-ethylmorpholine group provides the compound with solubility and stability in various solvents. ((2-azido-4-benzyl)phenoxy)-N-ethylmorpholine has potential applications in drug discovery and development, as well as in the synthesis of novel materials and chemical intermediates.
Check Digit Verification of cas no
The CAS Registry Mumber 130755-08-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,7,5 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 130755-08:
(8*1)+(7*3)+(6*0)+(5*7)+(4*5)+(3*5)+(2*0)+(1*8)=107
107 % 10 = 7
So 130755-08-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H22N4O2/c20-22-21-18-15-17(14-16-4-2-1-3-5-16)6-7-19(18)25-13-10-23-8-11-24-12-9-23/h1-7,15H,8-14H2