131922-15-1 Usage
Description
2-Benzofuranyl glyoxal hydrate is a versatile chemical compound that serves as a key building block in the synthesis of various organic compounds and pharmaceuticals. It is characterized by its reactivity with different functional groups, enabling the formation of complex molecular structures. Additionally, it exhibits catalytic properties in certain chemical reactions, making it a valuable tool for chemists and pharmaceutical researchers in the development of new drugs and organic compounds.
Uses
Used in Organic Synthesis:
2-Benzofuranyl glyoxal hydrate is used as a building block for the synthesis of a wide range of organic compounds. Its reactivity with various functional groups allows for the creation of complex molecular structures, making it a valuable component in the development of new organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-Benzofuranyl glyoxal hydrate is used as a key intermediate in the synthesis of medicinal compounds. Its ability to form complex structures with different functional groups makes it a promising candidate for the development of new drugs with potential therapeutic applications.
Used as a Catalyst in Chemical Reactions:
2-Benzofuranyl glyoxal hydrate is also utilized as a catalyst in certain chemical reactions, enhancing the efficiency and selectivity of these processes. Its catalytic properties further expand its potential uses in organic synthesis and pharmaceutical research, contributing to the development of innovative and efficient synthetic routes for the production of desired compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 131922-15-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,9,2 and 2 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 131922-15:
(8*1)+(7*3)+(6*1)+(5*9)+(4*2)+(3*2)+(2*1)+(1*5)=101
101 % 10 = 1
So 131922-15-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H6O3.H2O/c11-6-8(12)10-5-7-3-1-2-4-9(7)13-10;/h1-6H;1H2
131922-15-1Relevant articles and documents
Metal-free dual sp3 C-H functionalization: I2- promoted domino oxidative cyclization to construct 2,5-disubstituted oxazoles
Gao, Qing-He,Fei, Zhuan,Zhu, Yan-Ping,Lian, Mi,Jia, Feng-Cheng,Liu, Mei-Cai,She, Neng-Fang,Wu, An-Xin
, p. 22 - 28 (2013/01/15)
An I2-promoted sp3 C-H functionalization has been developed for the synthesis of 2,5-disubstituted oxazoles from easily available methyl ketones and benzylamines without any metal and peroxide catalyst. This domino oxidative cyclization process involves the cleavage of C-H bond and the formation of C-N, C-O bonds.
Reactions of α-imino ketones derived from arylglyoxals with (trifluoromethyl)trimethylsilane; A new route to β-amino-α- trifluoromethyl alcohols
Mloston, Grzegorz,Obijalska, Emilia,Tafelska-Kaczmarek, Agnieszka,Zaidlewicz, Marek
scheme or table, p. 1289 - 1296 (2011/02/22)
The reactions of α-imino ketones, derived from arylglyoxals, with (trifluoromethyl)trimethylsilane (CF3SiMe3) in DME solution, in the presence of catalytic amount of CsF, at room temperature, yield O-silylated β-imino alcohols in the
