132733-02-9 Usage
General Description
The chemical compound "(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methyl-pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-carbamoyl-butanoyl]amino]-3-phenyl-propanoic acid" is a complex peptide consisting of multiple amino acids. It has a molecular structure with multiple amine and carboxylic acid functional groups. (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methyl-pentanoyl]am ino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylidene amino)pentanoyl]amino]-4-carbamoyl-butanoyl]amino]-3-phenyl-propanoic acid belongs to a class of chemicals known as peptides, which are vital building blocks of proteins. The chemical name indicates that it is a derivative of propanoic acid with specific configurations of amino acid residues and functional groups. The compound has potential applications in pharmaceutical research and drug development due to its complex structure and potential biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 132733-02-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,7,3 and 3 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 132733-02:
(8*1)+(7*3)+(6*2)+(5*7)+(4*3)+(3*3)+(2*0)+(1*2)=99
99 % 10 = 9
So 132733-02-9 is a valid CAS Registry Number.
InChI:InChI=1/C32H54N12O7/c1-18(2)16-20(33)26(46)41-21(10-6-14-39-31(35)36)27(47)42-22(11-7-15-40-32(37)38)28(48)43-23(12-13-25(34)45)29(49)44-24(30(50)51)17-19-8-4-3-5-9-19/h3-5,8-9,18,20-24H,6-7,10-17,33H2,1-2H3,(H2,34,45)(H,41,46)(H,42,47)(H,43,48)(H,44,49)(H,50,51)(H4,35,36,39)(H4,37,38,40)/t20-,21-,22-,23-,24-/m0/s1