13350-41-9 Usage
Chemical Class
Thiohydantoin
Explanation
Different sources of media describe the Explanation of 13350-41-9 differently. You can refer to the following data:
1. The compound belongs to the thiohydantoin class of compounds, which are known for their anticonvulsant and sedative properties.
2. The compound contains a carboxymethyl group (-COOH), which is a functional group consisting of a carbonyl (C=O) and a hydroxyl (OH) group attached to a carbon atom.
3. The compound has a phenyl group (C6H5), which is a hydrocarbon group consisting of a six-membered aromatic ring with alternating single and double carbon-carbon bonds.
4. The compound contains an ethyl-benzoxazolinylidene group, which is a complex organic group derived from benzoxazole, a five-membered nitrogen-containing heterocycle fused to a benzene ring.
5. Thiohydantoins, in general, are known for their anticonvulsant properties, which means this compound may have the potential to prevent or reduce the severity of seizures.
6. Thiohydantoins are also known for their sedative properties, suggesting that this compound may have the potential to induce a calming or soothing effect.
7. Due to its anticonvulsant and sedative properties, this compound may have potential applications in the field of medicine, particularly in the treatment of conditions like epilepsy or anxiety.
8. More research is needed to fully understand the specific properties, potential uses, and safety profile of this compound in medicine or other fields.
9. The compound has a complex chemical structure, which includes multiple functional groups and a fused aromatic ring system.
10. The molecular formula for this compound is not provided in the material, but it can be derived from the given information about its constituent groups and atoms.
Carboxymethyl Group
Present
Phenyl Group
Present
Ethyl-benzoxazolinylidene Group
Present
Anticonvulsant Properties
Potential
Sedative Properties
Potential
Pharmacological Applications
Potential
Further Research
Required
Chemical Structure
Complex
Check Digit Verification of cas no
The CAS Registry Mumber 13350-41-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,5 and 0 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13350-41:
(7*1)+(6*3)+(5*3)+(4*5)+(3*0)+(2*4)+(1*1)=69
69 % 10 = 9
So 13350-41-9 is a valid CAS Registry Number.
InChI:InChI=1/C22H19N3O4S/c1-2-23-16-10-6-7-11-18(16)29-19(23)13-12-17-21(28)25(15-8-4-3-5-9-15)22(30)24(17)14-20(26)27/h3-13H,2,14H2,1H3,(H,26,27)/b17-12-,19-13-