13442-11-0 Usage
Description
(NZ)-N-(5-chloro-1-hydroxy-quinolin-4-ylidene)hydroxylamine, also known as NQH, is a chemical compound that features a quinoline ring structure and a chlorinated hydroxy group. It is a hydroxylamine derivative with potential applications in both the pharmaceutical and agricultural industries. NQH has garnered interest due to its unique structure and the possibility of its use in the synthesis of various heterocyclic compounds with pharmacological activities. Additionally, it has been investigated for its role in developing new agrochemicals with anti-inflammatory and anti-fungal properties, making it a promising area for further research and development.
Uses
Used in Pharmaceutical Industry:
(NZ)-N-(5-chloro-1-hydroxy-quinolin-4-ylidene)hydroxylamine is used as a building block for the synthesis of heterocyclic compounds with potential pharmacological activities. Its unique structure allows for the creation of new compounds that could have various therapeutic applications, contributing to the development of novel drugs.
Used in Agricultural Industry:
(NZ)-N-(5-chloro-1-hydroxy-quinolin-4-ylidene)hydroxylamine is used as a component in the development of new agrochemicals. Its potential anti-inflammatory and anti-fungal properties make it a valuable candidate for creating more effective and targeted treatments in agriculture, potentially leading to improved crop yields and protection against various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 13442-11-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,4,4 and 2 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13442-11:
(7*1)+(6*3)+(5*4)+(4*4)+(3*2)+(2*1)+(1*1)=70
70 % 10 = 0
So 13442-11-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2O2/c10-6-2-1-3-8-9(6)7(11-13)4-5-12(8)14/h1-5,13-14H/b11-7+