13555-64-1 Usage
Molecular structure
2-[(2-cyanoethyl)[4-[(2-cyano-4-nitrophenyl)azo]phenyl]amino]ethyl phenoxyacetate has a complex and long molecular structure, which includes phenoxyacetate, cyano, nitro, and azo groups.
Functional groups
The presence of multiple functional groups, such as cyano, nitro, azo, and phenoxyacetate, in the compound's structure contributes to its unique properties and potential applications.
Potential applications
Due to its complex structure and various functional groups, the compound may have potential applications in fields like organic synthesis, materials science, and pharmaceutical research.
Further analysis required
The exact properties and potential uses of this compound are not fully known and would require further investigation and analysis by experts in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 13555-64-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,5,5 and 5 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 13555-64:
(7*1)+(6*3)+(5*5)+(4*5)+(3*5)+(2*6)+(1*4)=101
101 % 10 = 1
So 13555-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C26H22N6O5/c27-13-4-14-31(15-16-36-26(33)19-37-24-5-2-1-3-6-24)22-9-7-21(8-10-22)29-30-25-12-11-23(32(34)35)17-20(25)18-28/h1-3,5-12,17H,4,14-16,19H2/b30-29+