137027-51-1 Usage
Molecular structure
2,6-diamino-3,4-dimethyl-7-oxopyrano(4,3-g)benzimidazole has a complex and distinctive molecular structure, which includes a benzimidazole core, a pyrano ring, and an oxo group.
Amino groups
The compound contains two amino groups (-NH2) at the 2nd and 6th positions, which contribute to its chemical reactivity and potential applications in various fields.
Benzimidazole family
It is derived from the benzimidazole family of compounds, which are known for their diverse biological activities and potential applications in pharmaceuticals, agrochemicals, and materials science.
Pyrano ring
The presence of a pyrano ring (a six-membered oxygen-containing ring) in its structure contributes to its unique chemical properties and potential applications.
Oxo group
The 7-oxo group (a double-bonded oxygen atom) in the compound's structure further enhances its chemical reactivity and potential applications in various fields.
Organic chemistry and drug discovery
The compound's specific structure and functional groups make it a promising candidate for further research and development in the field of organic chemistry and drug discovery, as it may exhibit unique biological activities and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 137027-51-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,0,2 and 7 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 137027-51:
(8*1)+(7*3)+(6*7)+(5*0)+(4*2)+(3*7)+(2*5)+(1*1)=111
111 % 10 = 1
So 137027-51-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N4O2/c1-5-3-6-7(4-18-11(17)8(6)13)9-10(5)16(2)12(14)15-9/h3-4H,13H2,1-2H3,(H2,14,15)
