137927-75-4 Usage
General Description
((6-(4-Chlorophenoxy)-4-pyrimidinyl)thio)acetic acid hydrazide is a chemical compound that is used in the field of medicinal chemistry. It is a thioacetic acid derivative containing a hydrazide functional group. ((6-(4-Chlorophenoxy)-4-pyrimidinyl)thio)acetic acid hydrazide has potential use as a pesticide or herbicide due to its ability to inhibit plant growth. Additionally, it has shown promising biological activity as an antitumor agent, making it a potential candidate for cancer treatment. Further research is needed to fully understand the potential applications and mechanisms of action of ((6-(4-Chlorophenoxy)-4-pyrimidinyl)thio)acetic acid hydrazide.
Check Digit Verification of cas no
The CAS Registry Mumber 137927-75-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,9,2 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 137927-75:
(8*1)+(7*3)+(6*7)+(5*9)+(4*2)+(3*7)+(2*7)+(1*5)=164
164 % 10 = 4
So 137927-75-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H11ClN4O2S/c13-8-1-3-9(4-2-8)19-11-5-12(16-7-15-11)20-6-10(18)17-14/h1-5,7H,6,14H2,(H,17,18)
