13898-68-5 Usage
General Description
3-ethoxy-N,N-diethyl-4-hydroxybenzamide is a chemical compound that consists of a benzamide group with an ethoxy and diethyl substituents on the nitrogen atom and a hydroxyl group on the 4-position of the benzene ring. It is a white to off-white solid with a molecular formula C15H23NO3 and a molecular weight of 269.35 g/mol. 3-ethoxy-N,N-diethyl-4-hydroxybenzamide is used in pharmaceutical research as a potential drug candidate due to its potential biological activities, such as anti-inflammatory, analgesic, and neuroprotective properties. Additionally, it may also have applications in the development of new drugs for the treatment of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 13898-68-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,8,9 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 13898-68:
(7*1)+(6*3)+(5*8)+(4*9)+(3*8)+(2*6)+(1*8)=145
145 % 10 = 5
So 13898-68-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO3/c1-4-14(5-2)13(16)10-7-8-11(15)12(9-10)17-6-3/h7-9,15H,4-6H2,1-3H3