14429-43-7 Usage
General Description
"(R)-Acetylamino-cyclohexyl-acetic acid" is a type of organic compound which belongs to the class of chemicals known as amino acids and derivatives. (R)-ACETYLAMINO-CYCLOHEXYL-ACETIC ACID is characterized by an amino acid or a derivative thereof which contains an additional carboxyl group or a derivative thereof attached to the alpha carbon atom. Its chemical formula is C12H21NO4, although it is not widely researched, it is expected to possess various chemical behaviors typical of amino acids. The presence of the 'R'- prefix in the name indicates that the compound has a specific spatial configuration in three-dimensional space known as the 'R' (rectus) form, which is one of the forms possible due to chirality or 'handedness' in chemical structures. Its potential uses and specific physical or chemical properties would depend on its detailed molecular structure and would require further research for full elucidation.
Check Digit Verification of cas no
The CAS Registry Mumber 14429-43-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,4,2 and 9 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14429-43:
(7*1)+(6*4)+(5*4)+(4*2)+(3*9)+(2*4)+(1*3)=97
97 % 10 = 7
So 14429-43-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H17NO3/c1-7(12)11-9(10(13)14)8-5-3-2-4-6-8/h8-9H,2-6H2,1H3,(H,11,12)(H,13,14)/t9-/m1/s1
14429-43-7Relevant articles and documents
IMIDAZOTRIAZINONE DERIVATIVES AS PDE 7 (PHOSPHODIESTERASE 7) INHIBITORS
-
Page/Page column 20, (2010/02/10)
The present invention provides the compounds inhibiting PDE 7 selectively, and therefore, enhances cellular cAMP level. Consequently, the compound is useful for treating various kinds of disease such as allergic disease, inflammatory disease or immunologi
