15009-92-4 Usage
Description
2,5-DINITROPYRIDINE, with the molecular formula C5H3N3O4, is a yellow crystalline solid that is insoluble in water. It is a chemical compound known for its high reactivity and potential hazards, necessitating careful handling and proper safety measures.
Uses
Used in Pharmaceutical Industry:
2,5-DINITROPYRIDINE is used as an intermediate in the production of pharmaceuticals for its ability to be incorporated into various drug molecules, contributing to the development of new medications.
Used in Dye Industry:
In the dye industry, 2,5-DINITROPYRIDINE is utilized as an intermediate, playing a role in the synthesis of dyes that require its specific chemical properties to achieve desired color characteristics.
Used in Agrochemical Industry:
2,5-DINITROPYRIDINE serves as an intermediate in the production of agrochemicals, where it is involved in the synthesis of compounds that help in the development of pesticides and other agricultural chemicals to protect crops.
Used in Organic Compounds Synthesis:
2,5-DINITROPYRIDINE is used in the synthesis of other organic compounds, highlighting its versatility in organic chemistry and its ability to be a building block for a wide range of chemical products.
Used as a Reagent in Chemical Reactions:
As a reagent, 2,5-DINITROPYRIDINE is employed in various chemical reactions, facilitating specific transformations and processes that are essential in the synthesis and production of different chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 15009-92-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,0,0 and 9 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 15009-92:
(7*1)+(6*5)+(5*0)+(4*0)+(3*9)+(2*9)+(1*2)=84
84 % 10 = 4
So 15009-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H3N3O4/c9-7(10)4-1-2-5(6-3-4)8(11)12/h1-3H
15009-92-4Relevant articles and documents
Synthesis of 5-nitropyridin-2-ylazo push-pull derivatives
Kreicberga,Jecs,Kampars
, p. 29 - 34 (2008/12/22)
A practical method has been devised for the synthesis of previously unknown push-pull azochromophores with 5-nitropyridin-2-yl acceptor moiety from 2-amino-5-nitro-1-oxypyridine.
