15026-82-1 Usage
General Description
1-(4-Chloro-benzoylamino)-cyclopentanecarboxylic acid is a chemical compound with the molecular formula C15H15ClNO3. It is a derivative of cyclopentanecarboxylic acid, with a 4-chloro-benzoylamino group attached. 1-(4-Chloro-benzoylamino)-cyclopentanecarboxylic acid is a white to off-white powder, and it is commonly used in organic synthesis and pharmaceutical research. Its main applications include its use as a building block for the synthesis of various pharmaceutical compounds and as a precursor in the preparation of other chemical entities. It may also have potential biological activities due to its structural features, making it a valuable compound for further research and development in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 15026-82-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,0,2 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 15026-82:
(7*1)+(6*5)+(5*0)+(4*2)+(3*6)+(2*8)+(1*2)=81
81 % 10 = 1
So 15026-82-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H14ClNO3/c14-10-5-3-9(4-6-10)11(16)15-13(12(17)18)7-1-2-8-13/h3-6H,1-2,7-8H2,(H,15,16)(H,17,18)