1549-50-4 Usage
General Description
N-(4-fluoro-phenyl)-[1,3,5]triazine-2,4-diamine is a chemical compound that belongs to the class of triazine derivatives. It is characterized by the presence of a triazine ring with two amino groups and a 4-fluoro-phenyl group attached to it. N-(4-FLUORO-PHENYL)-[1,3,5]TRIAZINE-2,4-DIAMINE has potential applications in the field of medicine, specifically in the development of pharmaceutical drugs and therapies. Its unique structure and properties make it a valuable building block for the synthesis of various bioactive molecules. Additionally, its fluorinated phenyl group makes it potentially useful in the field of agrochemicals and crop protection. Further research and exploration of its properties and potential uses are ongoing.
Check Digit Verification of cas no
The CAS Registry Mumber 1549-50-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,4 and 9 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1549-50:
(6*1)+(5*5)+(4*4)+(3*9)+(2*5)+(1*0)=84
84 % 10 = 4
So 1549-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H8FN5/c10-6-1-3-7(4-2-6)14-9-13-5-12-8(11)15-9/h1-5H,(H3,11,12,13,14,15)