15989-99-8 Usage
Appearance
White solid The compound has a white solid form, which is a common characteristic for many organic compounds.
Solubility
Soluble in most organic solvents This property allows the compound to be used in various chemical reactions, as it can dissolve in common organic solvents like ethanol, acetone, and dichloromethane.
Use as a reagent
Acylation of alcohols and amines 2,3,4,5,6-Pentafluorobenzoic anhydride is commonly used to modify alcohols and amines by introducing an acyl group, which is a crucial step in the synthesis of many organic compounds.
Applications
Production of pharmaceuticals and agrochemicals The compound is used in the manufacturing of various drugs and agrochemicals, which highlights its importance in the chemical industry.
Reactivity and stability
High reactivity and stability These properties make the compound a valuable intermediate in the synthesis of various organic compounds, as it can easily react with other chemicals and maintain its structure during the reaction process.
Safety precautions
Corrosive and toxic if not properly managed It is essential to handle 2,3,4,5,6-Pentafluorobenzoic anhydride with care, as it can cause harm to both humans and the environment if not properly stored or disposed of.
Check Digit Verification of cas no
The CAS Registry Mumber 15989-99-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,9,8 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 15989-99:
(7*1)+(6*5)+(5*9)+(4*8)+(3*9)+(2*9)+(1*9)=168
168 % 10 = 8
So 15989-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C14F10O3/c15-3-1(4(16)8(20)11(23)7(3)19)13(25)27-14(26)2-5(17)9(21)12(24)10(22)6(2)18