159903-67-0 Usage
General Description
2,6-bis[2-amino-1-(6-bromo-1H-indol-3-yl)ethyl]-3-(2-aminoethyl)-1H-indol-5-ol is a highly complex chemical compound that consists of two indole rings connected by an ethylene bridge. It also contains two aminoethyl groups and a bromine substituent on one of the indole rings. 2,6-bis[2-amino-1-(6-bromo-1H-indol-3-yl)ethyl]-3-(2-aminoethyl)-1H-in dol-5-ol has a molecular formula of C26H28BrN5O and a molecular weight of 500.43 g/mol. It is a potential pharmaceutical intermediate and may have applications in organic synthesis and medicinal chemistry due to its unique structure and functional groups. However, further research and analysis are needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 159903-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,9,0 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 159903-67:
(8*1)+(7*5)+(6*9)+(5*9)+(4*0)+(3*3)+(2*6)+(1*7)=170
170 % 10 = 0
So 159903-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C30H30Br2N6O/c31-15-1-3-17-24(13-36-26(17)7-15)22(11-34)21-9-28-20(10-29(21)39)19(5-6-33)30(38-28)23(12-35)25-14-37-27-8-16(32)2-4-18(25)27/h1-4,7-10,13-14,22-23,36-39H,5-6,11-12,33-35H2