163180-68-5 Usage
General Description
3-Methyl-4-oxo-10-oxa-3-aza-tricyclo[5.2.1.0(1,5)]dec-8-ene-6-carboxylic acid is a complex chemical compound with a highly unique structure. It belongs to the class of tricyclic compounds and contains a carboxylic acid group. 3-METHYL-4-OXO-10-OXA-3-AZA-TRICYCLO[5.2.1.0(1,5)]DEC-8-ENE-6-CARBOXYLIC ACID is a derivative of tricyclics and contains a fused tricyclic ring system. It is also characterized by the presence of heteroatoms such as oxygen and nitrogen within its ring structure. 3-METHYL-4-OXO-10-OXA-3-AZA-TRICYCLO[5.2.1.0(1,5)]DEC-8-ENE-6-CARBOXYLIC ACID may have potential applications in research and pharmaceutical fields due to its intricate structure and potential biological activities. However, further research is needed to determine its specific properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 163180-68-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,1,8 and 0 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 163180-68:
(8*1)+(7*6)+(6*3)+(5*1)+(4*8)+(3*0)+(2*6)+(1*8)=125
125 % 10 = 5
So 163180-68-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO4/c1-11-4-10-3-2-5(15-10)6(9(13)14)7(10)8(11)12/h2-3,5-7H,4H2,1H3,(H,13,14)/p-1/t5-,6+,7-,10+/m1/s1
