1632-19-5 Usage
Description
DIMETHYL 3,4-DIHYDROXYPYRROLE-2,5-DICARBOXYLATE is a chemical compound characterized by the molecular formula C10H12N2O6. It is a diester derivative of 3,4-dihydroxypyrrole-2,5-dicarboxylic acid, known for its potential applications in the pharmaceutical and chemical industries. DIMETHYL 3,4-DIHYDROXYPYRROLE-2,5-DICARBOXYLATE serves as a versatile building block in the synthesis of heterocyclic compounds and other organic compounds, making it an important intermediate in organic synthesis. Careful handling is advised due to its potential hazardous properties if not used properly.
Uses
Used in Pharmaceutical Industry:
DIMETHYL 3,4-DIHYDROXYPYRROLE-2,5-DICARBOXYLATE is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Chemical Industry:
In the chemical industry, DIMETHYL 3,4-DIHYDROXYPYRROLE-2,5-DICARBOXYLATE is utilized as a building block for the production of heterocyclic compounds. Its versatility in organic synthesis contributes to the creation of a wide range of chemical products.
Used in Organic Synthesis:
DIMETHYL 3,4-DIHYDROXYPYRROLE-2,5-DICARBOXYLATE is employed as a crucial intermediate in organic synthesis, enabling the formation of complex organic molecules. Its presence in various chemical reactions facilitates the development of innovative compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1632-19-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,3 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1632-19:
(6*1)+(5*6)+(4*3)+(3*2)+(2*1)+(1*9)=65
65 % 10 = 5
So 1632-19-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO6/c1-3(10)15-7-6(12)5(11)4(9-7)8(13)14-2/h9,11-12H,1-2H3
1632-19-5Relevant articles and documents
A general method for the synthesis of N-unsubstituted 3,4-diarylpyrrole-2, 5-dicarboxylates
Fukuda, Tsutomu,Hayashida, Yukie,Iwao, Masatomo
experimental part, p. 1105 - 1122 (2010/09/16)
A general method for the synthesis of N-unsubstituted 3,4-diarylpyrrole-2, 5-dicarboxylates (3) has been developed. The key reactions involved are the Hinsberg-type synthesis of dimethyl N-benzyl-3,4-dihydroxypyrrole-2,5- dicarboxylate (6) followed by palladium-catalyzed Suzuki-Miyaura coupling of its bis-triflate derivative (7). The N-benzyl protecting group of the resulting 3,4-diaryl pyrrole-2,5-dicarboxyl ates (8) is cleanly removed under hydrogenolytic or solvolytic conditions.