164330-69-2 Usage
Description
Ethyl 1-(2-amino-5-methylphenyl)-5-methyl-1H-imidazole-4-carboxylate is a complex chemical compound that features an imidazole ring and an ethyl ester group. Derived from imidazole, this compound incorporates an amino group and a methyl group, which contribute to its biological activity. Its unique structural features suggest potential pharmaceutical applications, enabling it to influence a range of biological processes.
Uses
Used in Pharmaceutical Applications:
Ethyl 1-(2-amino-5-methylphenyl)-5-methyl-1H-imidazole-4-carboxylate serves as a biologically active compound for the development of pharmaceuticals, leveraging its structural attributes to modulate various biological processes. Its potential use in medicinal chemistry is significant, given its capacity to interact with biological targets and systems.
Used in Research Applications:
In the field of scientific research, ethyl 1-(2-amino-5-methylphenyl)-5-methyl-1H-imidazole-4-carboxylate is utilized as a research chemical. It aids in the investigation of imidazole-based compounds and their effects on biological systems, contributing to the advancement of knowledge in medicinal chemistry and related disciplines.
Used in Industrial Applications:
Ethyl 1-(2-amino-5-methylphenyl)-5-methyl-1H-imidazole-4-carboxylate may also find use in industrial applications, where its unique chemical properties can be harnessed for specific processes or the synthesis of other compounds. Its role in industry can be diverse, depending on the requirements of various chemical processes or the development of new materials.
It is crucial to handle ethyl 1-(2-amino-5-methylphenyl)-5-methyl-1H-imidazole-4-carboxylate with care and adhere to safety guidelines to ensure the safety of individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 164330-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,4,3,3 and 0 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 164330-69:
(8*1)+(7*6)+(6*4)+(5*3)+(4*3)+(3*0)+(2*6)+(1*9)=122
122 % 10 = 2
So 164330-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H17N3O2/c1-4-19-14(18)13-10(3)17(8-16-13)12-7-9(2)5-6-11(12)15/h5-8H,4,15H2,1-3H3