16784-24-0 Usage
General Description
1,3,4-Thiadiazol-2-amine, 5-propoxy- is a chemical compound that belongs to the family of thiadiazoleamines. It is characterized by the presence of a thiadiazole ring with an amine group attached at the 2-position and a propoxy group attached at the 5-position. 1,3,4-Thiadiazol-2-amine, 5-propoxy- has potential applications in pharmaceutical and agricultural industries, as it may exhibit biological activity and could be used as a building block for the synthesis of various organic compounds. Additionally, it may also have potential use as an intermediate in the production of other chemical compounds. Further research and testing are needed to fully understand the properties and potential uses of 1,3,4-Thiadiazol-2-amine, 5-propoxy-.
Check Digit Verification of cas no
The CAS Registry Mumber 16784-24-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,7,8 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16784-24:
(7*1)+(6*6)+(5*7)+(4*8)+(3*4)+(2*2)+(1*4)=130
130 % 10 = 0
So 16784-24-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3OS/c1-2-3-9-5-8-7-4(6)10-5/h2-3H2,1H3,(H2,6,7)