1692-45-1 Usage
Description
2,3-dihydro-2-phenyl-4-benzopyrone (2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone is a hydrazone-based chemical compound derived from 2,3-dihydro-2-phenyl-4-benzopyrone, featuring a unique structure with a hydrazone functional group. It has been investigated for its potential biological activities, such as antimicrobial, antioxidant, and anti-inflammatory properties, and is considered a promising candidate for applications in pharmaceuticals and materials science due to its versatile chemical properties.
Uses
Used in Pharmaceutical Industry:
2,3-dihydro-2-phenyl-4-benzopyrone (2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone is used as a pharmaceutical agent for its potential antimicrobial, antioxidant, and anti-inflammatory properties. Its diverse biological activities make it a candidate for the development of new drugs to combat various diseases and conditions.
Used in Materials Science:
In the field of materials science, 2,3-dihydro-2-phenyl-4-benzopyrone (2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone is utilized for its unique chemical structure, which may contribute to the development of novel materials with specific properties, such as improved stability or reactivity.
Overall, 2,3-dihydro-2-phenyl-4-benzopyrone (2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone is a versatile compound with potential applications in various industries, including pharmaceuticals and materials science, due to its distinct chemical properties and biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 1692-45-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,9 and 2 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1692-45:
(6*1)+(5*6)+(4*9)+(3*2)+(2*4)+(1*5)=91
91 % 10 = 1
So 1692-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C30H24N2O2/c1-3-11-21(12-4-1)29-19-25(23-15-7-9-17-27(23)33-29)31-32-26-20-30(22-13-5-2-6-14-22)34-28-18-10-8-16-24(26)28/h1-18,29-30H,19-20H2/b31-25-,32-26+