17321-29-8 Usage
Description
3-Bromo-6-methoxypyridazine is a pyridazine derivative with the molecular formula C5H5BrN2O and a molecular weight of 188.01 g/mol. It is characterized by the presence of a bromine atom and a methoxy group, making it a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals. This chemical compound is known for its reactivity with various functional groups in organic chemistry and has been explored for its potential applications in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
3-Bromo-6-methoxypyridazine is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the formation of diverse organic molecules with potential therapeutic properties. 3-Bromo-6-methoxypyridazine's reactivity with different functional groups enables the development of new drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical industry, 3-Bromo-6-methoxypyridazine serves as an essential building block for the production of various agrochemicals, such as pesticides and herbicides. Its ability to react with multiple functional groups allows for the creation of novel compounds with enhanced pesticidal or herbicidal activity, contributing to more effective crop protection strategies.
Used in Medicinal Chemistry Research:
3-Bromo-6-methoxypyridazine is utilized as a valuable research tool in medicinal chemistry. Its potential applications in the development of new drugs and therapeutic agents make it an attractive candidate for further investigation. Researchers can explore its interactions with various biological targets and evaluate its efficacy in treating specific diseases or conditions.
Used in Organic Chemistry:
3-Bromo-6-methoxypyridazine's reactivity with different functional groups makes it a useful compound in organic chemistry. It can be employed in various chemical reactions, such as substitution, addition, or condensation reactions, to synthesize more complex organic compounds with desired properties. This versatility allows chemists to explore new synthetic routes and develop innovative applications for this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 17321-29-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,2 and 1 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17321-29:
(7*1)+(6*7)+(5*3)+(4*2)+(3*1)+(2*2)+(1*9)=88
88 % 10 = 8
So 17321-29-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BrN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3
17321-29-8Relevant articles and documents
TYK2 PSEUDOKINASE LIGANDS
-
Paragraph 0350; 0351, (2021/05/14)
Described herein are TYK2 pseudokinase ligands and methods of utilizing TYK2 pseudokinase ligands in the treatment of diseases, disorders or conditions. Also described herein are pharmaceutical compositions containing such compounds.
SUBSTITUTED (AMINOIMINOMETHYL OR AMINOMETHYL) BENZOHETEROARYL COMPOUNDS
-
, (2008/06/13)
This invention is directed to an (aminoiminomethyl or aminomethyl) benzoheteroaryl compound of formula I which is useful for inhibiting the activity of Factor Xa by combining said compound with a composition containing Factor Xa. The present invention is also directed to compositions containing compounds of the formula I, methods for their preparation, their use, such as in inhibiting the formation of thrombin or for treating a patient suffering from, or subject to, a disease state associated with a physiologically detrimental excess amount of thrombin.