174079-87-9 Usage
General Description
The chemical compound "(1alpha,4beta[E(trans)]-1-{4-[2-(-(-vinylcyclohexyl)ethenyl)ethenyl)ethenyl]-cyclohexyl}-4-methoxy-benzol" is a complex organic molecule with an unusual structural arrangement. It contains a combination of cyclohexyl, methoxy, and benzene groups, as well as multiple vinyl and ethenyl functional groups. The compound is composed of multiple carbon-carbon double bonds, which give it a high degree of unsaturation. The specific arrangement and stereochemistry of the functional groups in this compound give it unique properties and potential applications in organic synthesis, pharmaceuticals, or materials science. Due to its complex structure, it may have a diverse range of reactivity and potential biological or industrial uses.
Check Digit Verification of cas no
The CAS Registry Mumber 174079-87-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,0,7 and 9 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 174079-87:
(8*1)+(7*7)+(6*4)+(5*0)+(4*7)+(3*9)+(2*8)+(1*7)=159
159 % 10 = 9
So 174079-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C23H32O/c1-3-18-4-6-19(7-5-18)8-9-20-10-12-21(13-11-20)22-14-16-23(24-2)17-15-22/h3,8-9,14-21H,1,4-7,10-13H2,2H3/b9-8+/t18-,19-,20-,21-