175201-62-4 Usage
General Description
4-(4,5-Dichloro-1H-imidazol-1-yl)aniline is a chemical compound with the molecular formula C9H7Cl2N3. It is an aniline derivative with a substituted imidazole ring. 4-(4,5-DICHLORO-1H-IMIDAZOL-1-YL)ANILINE is commonly used in pharmaceutical and research applications as a building block for the synthesis of various drugs and pharmaceutical intermediates. Its unique imidazole structure makes it valuable for its potential biological and pharmacological activities. Additionally, 4-(4,5-Dichloro-1H-imidazol-1-yl)aniline has also been studied for its use in the preparation of dyes, pigments, and other organic compounds. Overall, this chemical plays a significant role in medicinal chemistry and organic synthesis due to its structural and functional properties.
Check Digit Verification of cas no
The CAS Registry Mumber 175201-62-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 1 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175201-62:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*1)+(2*6)+(1*2)=114
114 % 10 = 4
So 175201-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H7Cl2N3/c10-8-9(11)14(5-13-8)7-3-1-6(12)2-4-7/h1-5H,12H2
