175201-90-8 Usage
General Description
4-(3-Aminophenyl)-2-methylpyrimidine is a chemical compound which falls within the class known as pyrimidines and derivatives. Pyrimidines are aromatic heterocyclic compounds that consist of two nitrogen atoms and four carbon atoms in a six-membered ring with two nitrogens at non-adjacent positions. The 4-(3-aminophenyl)-2-methylpyrimidine exhibits its unique properties due to the structural makeup, which involves the presence of an aminophenyl group and a methyl group attached to a pyrimidine ring. Detailed information related to the compound's specific physical and chemical properties, including its solubility, melting and boiling points, or potential uses and safety measures, can vary and are typically provided in specialized chemical resources or safety data sheets.
Check Digit Verification of cas no
The CAS Registry Mumber 175201-90-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 1 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175201-90:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*1)+(2*9)+(1*0)=118
118 % 10 = 8
So 175201-90-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3/c1-8-13-6-5-11(14-8)9-3-2-4-10(12)7-9/h2-7H,12H2,1H3
