175203-24-4 Usage
General Description
3-(4-Bromo-3,5-dimethyl-pyrazol-1-ylmethyl)-benzoic acid is a chemical compound commonly used in the synthesis of pharmaceuticals and agrochemicals. It is a benzoic acid derivative with a pyrazole group attached to the benzene ring. The bromo and methyl substituents on the pyrazole ring contribute to its reactivity and pharmacological properties. 3-(4-BROMO-3,5-DIMETHYL-PYRAZOL-1-YLMETHYL)-BENZOIC ACID is often used as a building block for the production of various drugs and agricultural chemicals due to its potential for targeting specific biological pathways and enzymatic processes. Its molecular structure and functional groups make it a versatile and valuable compound for the development of new chemical entities with potential therapeutic and agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-24-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175203-24:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*2)+(1*4)=114
114 % 10 = 4
So 175203-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H13BrN2O2/c1-8-12(14)9(2)16(15-8)7-10-4-3-5-11(6-10)13(17)18/h3-6H,7H2,1-2H3,(H,17,18)