1758-74-3 Usage
Description
2-Guanidinopropionic acid, also known as guanidinoacetic acid or GAA, is a chemical compound derived from the amino acid glycine. It plays a crucial role in the synthesis of creatine, an essential molecule for providing energy to muscle cells. GAA is commonly used as a dietary supplement to increase creatine levels in the body and has been studied for its potential therapeutic effects on muscle function, cognitive function, and overall physical performance. Furthermore, it has been investigated for its possible role in treating conditions such as heart failure and neurodegenerative diseases.
Uses
Used in Dietary Supplements:
2-Guanidinopropionic acid is used as a dietary supplement for increasing creatine levels in the body. This helps in enhancing muscle function, cognitive function, and overall physical performance.
Used in Pharmaceutical Industry:
2-Guanidinopropionic acid is used as a potential therapeutic agent for improving muscle function and cognitive function in various conditions.
Used in Research:
2-Guanidinopropionic acid is used in research for studying its potential role in treating heart failure and neurodegenerative diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 1758-74-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,5 and 8 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1758-74:
(6*1)+(5*7)+(4*5)+(3*8)+(2*7)+(1*4)=103
103 % 10 = 3
So 1758-74-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H9N3O2/c1-2(3(8)9)7-4(5)6/h2H,1H3,(H,8,9)(H4,5,6,7)/t2-/m0/s1
1758-74-3Relevant articles and documents
Preparation of N-formamidinylamino acids from amino and formamidinesulfinic acids
Jursic,Neumann,McPherson
, p. 1656 - 1658 (2000)
A practical synthetic procedure for the conversion of amino acids into N-formamidinylamino acids using formamidinesulfinic acid in basic water solution is presented.