179756-90-2 Usage
Description
4-Chloro-2-piperazin-1-yl-pyrimidine is a chemical compound that serves as an intermediate in the synthesis of pharmaceuticals and other organic chemicals. It is a member of the piperazine class, characterized by a six-membered ring with two nitrogen atoms and four carbon atoms. The systematic name for this compound is 4-chloro-1-(piperazin-1-yl)pyrimidine, and it has a molecular formula of C8H10ClN5. 4-Chloro-2-piperazin-1-yl-pyrimidine's physical and chemical properties, as well as its toxicity and potential health effects, are contingent upon the specific compounds or drugs it is used to produce. Careful handling and storage are essential to prevent exposure and protect users from potential harm.
Uses
Used in Pharmaceutical Industry:
4-Chloro-2-piperazin-1-yl-pyrimidine is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its role in drug production is crucial, as it can be incorporated into the molecular structures of different medications, potentially enhancing their therapeutic effects and properties.
Used in Organic Chemistry:
In the field of organic chemistry, 4-Chloro-2-piperazin-1-yl-pyrimidine is utilized as a building block for the creation of more complex organic compounds. Its unique structure allows for further chemical reactions and modifications, making it a valuable component in the synthesis of a wide range of organic chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 179756-90-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,9,7,5 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 179756-90:
(8*1)+(7*7)+(6*9)+(5*7)+(4*5)+(3*6)+(2*9)+(1*0)=202
202 % 10 = 2
So 179756-90-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H11ClN4/c9-7-1-2-11-8(12-7)13-5-3-10-4-6-13/h1-2,10H,3-6H2
