18455-25-9 Usage
Description
Furanomycin is a non-proteinogenic L-alpha-amino acid derived from L-alanine, with the methyl group replaced by a (2R,5S)-5-methyl-2,5-dihydrofuran-2-yl moiety. It is a unique compound with potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Furanomycin is used as a pharmaceutical compound for its potential therapeutic properties. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Research:
Furanomycin is used as a research compound in chemical studies. Its distinct structure and properties make it an interesting subject for scientific investigation, potentially leading to new discoveries and applications.
Used in Biochemical Analysis:
Furanomycin can be used as a biochemical marker or analytical tool in various research and diagnostic applications. Its unique chemical properties may enable the detection or measurement of specific biological processes or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 18455-25-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,4,5 and 5 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 18455-25:
(7*1)+(6*8)+(5*4)+(4*5)+(3*5)+(2*2)+(1*5)=119
119 % 10 = 9
So 18455-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO3/c1-4-2-3-5(11-4)6(8)7(9)10/h2-6H,8H2,1H3,(H,9,10)