18698-73-2 Usage
General Description
3-(Methylthio)phenylacetic acid is a chemical compound with the molecular formula C9H10O2S. It is composed of a phenylacetic acid core with a methylthio group attached to the third carbon atom. 3-(METHYLTHIO)PHENYLACETIC ACID is commonly used as a pharmaceutical ingredient and is known for its anti-inflammatory and analgesic properties. It is often used in the synthesis of various drugs and pharmaceuticals, and its structure and properties make it suitable for use in medicinal applications. Additionally, 3-(methylthio)phenylacetic acid is also used in the production of fragrances and flavors due to its aromatic properties. Overall, this chemical compound has a range of practical applications in the pharmaceutical and fragrance industries.
Check Digit Verification of cas no
The CAS Registry Mumber 18698-73-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,6,9 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 18698-73:
(7*1)+(6*8)+(5*6)+(4*9)+(3*8)+(2*7)+(1*3)=162
162 % 10 = 2
So 18698-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10O2S/c1-12-8-4-2-3-7(5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11)
18698-73-2Relevant articles and documents
Pharmaceutically active benzoquinazoline compounds
-
Page 14, (2010/11/29)
Compounds of formula (I) or salts thereof, wherein the dotted line represents a single or double bond, R1is alkyl or amino optionally substituted by alkyl, alkanoyl or benzyl group; R2, R3, R4and R5are the same or different and each is selected from hydrogen, phenyl, halo, nitro, a group S(O)nR8wherein n is the integer 0, 1 or 2 and R8is halo or alkyl or a group NR9R10wherein R9and R10are both hydrogen, a group NR11R12wherein R11and R12are the same or different and each is hydrogen or alkyl, a group OR13wherein R13is hydrogen or C1-4alkyl optionally substituted by halo; a C1-4aliphatic group optionally substituted by a group OR14or NR14R15wherein R14and R15are the same or different and each is hydrogen or alkyl; or two of R2to R5are linked together to form a benzo group, or one of R2to R5is a group -X-Y-R16wherein X is CH2, NR17, CO or S(O)m, and Y is CH2, NR17, O, or S(O)m, or -X-Y- is a group -O-, -NR17-, -CH=CH- or -N=N-, are disclosed as pharmacological agents useful in the treatment of tumours. Pharmaceutical compositions and methods for the preparation of compounds of formula (I) are also described.
