18712-39-5 Usage
Description
(1,3,5-TRIMETHYL-1 H-PYRAZOL-4-YL)-METHANOL, a pyrazole derivative with the molecular formula C8H12N2O, is a five-membered heterocyclic ring containing three carbon atoms and two nitrogen atoms. This versatile chemical compound is widely recognized for its potential applications in both industry and research.
Uses
Used in Pharmaceutical Industry:
(1,3,5-TRIMETHYL-1 H-PYRAZOL-4-YL)-METHANOL is used as a building block for the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of a variety of compounds with potential medicinal properties.
Used in Agrochemical Industry:
In the agrochemical sector, (1,3,5-TRIMETHYL-1 H-PYRAZOL-4-YL)-METHANOL is employed as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness and provide targeted solutions for agricultural challenges.
Used in Organic Chemistry Research:
(1,3,5-TRIMETHYL-1 H-PYRAZOL-4-YL)-METHANOL is used as a reagent in organic chemistry reactions, facilitating the synthesis of complex molecules and compounds. Its presence in these reactions can lead to the discovery of new chemical entities and advancements in the field of organic chemistry.
Used in Biological Research:
(1,3,5-TRIMETHYL-1 H-PYRAZOL-4-YL)-METHANOL has been studied for its potential biological activities, such as anti-inflammatory and antioxidant properties. This research is crucial for understanding its potential applications in the development of new treatments and therapies for various health conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 18712-39-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,7,1 and 2 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18712-39:
(7*1)+(6*8)+(5*7)+(4*1)+(3*2)+(2*3)+(1*9)=115
115 % 10 = 5
So 18712-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2O/c1-5-7(4-10)6(2)9(3)8-5/h10H,4H2,1-3H3