18926-41-5 Usage
General Description
2-[(2-Ethoxy-2-oxoethyl)sulfanyl]benzenecarboxylic acid is a chemical compound with the molecular formula C12H14O5S. It is a derivative of benzenecarboxylic acid and contains a sulfur atom bonded to an ethoxy group and a benzene ring. 2-[(2-ETHOXY-2-OXOETHYL)SULFANYL]BENZENECARBOXYLIC ACID is often used in organic synthesis and pharmaceutical research due to its potential biological activity. Its structure and properties make it a valuable building block in the production of various drugs and pharmaceutical intermediates. Additionally, it has the potential to exhibit anti-inflammatory and antioxidant properties, making it a subject of interest for potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18926-41-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,9,2 and 6 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 18926-41:
(7*1)+(6*8)+(5*9)+(4*2)+(3*6)+(2*4)+(1*1)=135
135 % 10 = 5
So 18926-41-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O4S/c1-2-15-10(12)7-16-9-6-4-3-5-8(9)11(13)14/h3-6H,2,7H2,1H3,(H,13,14)/p-1
18926-41-5Relevant articles and documents
Benzoazacyclo compound, and preparation method and pharmaceutical application thereof
-
Paragraph 0129-0133, (2020/10/21)
The invention discloses a new benzoazacyclo compound shown as a formula I compound and physiologically acceptable salt, a solvate and a crystal form thereof, a preparation method of the compound, a pharmaceutical preparation containing the compound, and a