19152-92-2 Usage
General Description
2,4-diamino-6-methyl-7-hydroxypteridine is a chemical compound known for its role in the synthesis of folic acid, a crucial vitamin for DNA and RNA synthesis. It is an intermediate in the biochemical pathway that leads to the production of folic acid, which is essential for the growth and reproduction of cells. 2,4-diamino-6-methyl-7-hydroxypteridine is also used in the pharmaceutical industry as a starting material for the synthesis of various antifolate drugs, which are used in the treatment of cancer, bacterial, and parasitic infections. Additionally, 2,4-diamino-6-methyl-7-hydroxypteridine has potential applications in the development of new drugs and treatments for various diseases and medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 19152-92-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,1,5 and 2 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 19152-92:
(7*1)+(6*9)+(5*1)+(4*5)+(3*2)+(2*9)+(1*2)=112
112 % 10 = 2
So 19152-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N6O/c1-2-6(14)12-5-3(10-2)4(8)11-7(9)13-5/h1H3,(H5,8,9,11,12,13,14)
