1945-04-6 Usage
Chemical structure
1-[3-(3-phenylprop-2-ynyl)-3,8-diazabicyclo[3.2.1]oct-8-yl]propan-1-one is a complex organic molecule with a propanone group, a bicyclic ring system, and a phenylprop-2-ynyl group.
Bicyclic ring system
The compound contains a 3,8-diazabicyclo[3.2.1]oct-8-yl group, which is a bicyclic ring system with two nitrogen atoms.
Nitrogen atoms
The bicyclic ring system has two nitrogen atoms, which may contribute to the compound's potential pharmacological properties.
Propanone group
The compound is attached to a propanone group, which is a three-carbon ketone.
Phenylprop-2-ynyl group
The compound also contains a phenylprop-2-ynyl group, which is an alkyne with a phenyl group attached to a prop-2-yne.
Pharmacological potential
Due to the presence of the bicyclic ring system and the phenylprop-2-ynyl group, the compound may have potential pharmacological properties, such as acting as a nervous system stimulant or depressant.
Further research needed
More research is required to fully understand the biological effects and potential applications of this compound.
Molecular weight
The molecular weight of the compound is approximately 315.39 g/mol.
Appearance
The compound is likely to be a solid, based on its molecular weight and structure.
Check Digit Verification of cas no
The CAS Registry Mumber 1945-04-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,4 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1945-04:
(6*1)+(5*9)+(4*4)+(3*5)+(2*0)+(1*4)=86
86 % 10 = 6
So 1945-04-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N2O/c1-2-18(21)20-16-10-11-17(20)14-19(13-16)12-6-9-15-7-4-3-5-8-15/h3-5,7-8,16-17H,2,10-14H2,1H3
