1954-96-7 Usage
Description
5-AMINO-N-METHYLISOPHTHALAMIC ACID is a chemical compound characterized by the molecular formula C9H10N2O4. It is a derivative of isophthalic acid, featuring an amino group and a methyl group attached to the aromatic ring. This versatile chemical is widely recognized for its utility in the synthesis of pharmaceuticals, organic compounds, and as a monomer for polyamides. Additionally, it demonstrates potential as a corrosion inhibitor, making it a valuable asset in various industrial and research applications.
Uses
Used in Pharmaceutical Synthesis:
5-AMINO-N-METHYLISOPHTHALAMIC ACID is used as a building block for the synthesis of various pharmaceuticals and organic compounds. Its unique structure allows for the creation of diverse molecules with potential therapeutic properties.
Used in Corrosion Inhibition:
5-AMINO-N-METHYLISOPHTHALAMIC ACID is utilized as a corrosion inhibitor, providing protection against the degradation of materials in various industrial applications. Its ability to inhibit corrosion makes it a valuable component in formulations for coatings, paints, and other protective treatments.
Used in Polymer Production:
As a monomer, 5-AMINO-N-METHYLISOPHTHALAMIC ACID is used in the production of polyamides, contributing to the development of high-performance polymers with a range of applications in the plastics, textiles, and automotive industries.
Used in Research and Development:
5-AMINO-N-METHYLISOPHTHALAMIC ACID is employed in research and development for its potential applications in various fields, including material science, chemical engineering, and pharmaceutical innovation. Its versatility and unique properties make it a promising candidate for the exploration of new compounds and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 1954-96-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,5 and 4 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1954-96:
(6*1)+(5*9)+(4*5)+(3*4)+(2*9)+(1*6)=107
107 % 10 = 7
So 1954-96-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O3/c1-11-8(12)5-2-6(9(13)14)4-7(10)3-5/h2-4H,10H2,1H3,(H,11,12)(H,13,14)