19584-91-9 Usage
General Description
Hematoheme, also known as hemoglobin, is a complex iron-containing protein found in red blood cells. It is essential for transporting oxygen from the lungs to the tissues and organs throughout the body. Hematoheme is composed of four subunits, each containing a heme group that binds to oxygen. The heme group consists of a porphyrin ring with an iron ion at its center. This iron ion is capable of binding to oxygen, allowing hemoglobin to effectively carry and release oxygen as needed. Additionally, hemoglobin is involved in the transport of carbon dioxide from the tissues to the lungs for exhalation. Overall, hematoheme plays a crucial role in the oxygenation and carbon dioxide removal processes within the body.
Check Digit Verification of cas no
The CAS Registry Mumber 19584-91-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,5,8 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 19584-91:
(7*1)+(6*9)+(5*5)+(4*8)+(3*4)+(2*9)+(1*1)=149
149 % 10 = 9
So 19584-91-9 is a valid CAS Registry Number.
InChI:InChI=1/C34H38N4O6.Fe/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27;/h11-14,19-20,39-40H,7-10H2,1-6H3,(H4,35,36,37,38,41,42,43,44);/q;+2/p-2/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13-;